C11H12ClN3 — CID 7017721
1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-amine (PubChem CID 7017721) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-amine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 7017721 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5-methylpyrazol-3-amine |
| SMILES | Cc1cc(N)nn1Cc1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN3/c1-8-6-11(13)14-15(8)7-9-4-2-3-5-10(9)12/h2-6H,7H2,1H3,(H2,13,14) |
| InChIKey | FEAJPHNZDGHPCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |