C12H11F2N3O — CID 90351323
1-[(2,5-difluorophenyl)methyl]-5-methylpyrazole-3-carboxamide (PubChem CID 90351323) has the molecular formula C12H11F2N3O and a molecular weight of 251.24 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90351323 |
| Molecular Formula | C12H11F2N3O |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)nn1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C12H11F2N3O/c1-7-4-11(12(15)18)16-17(7)6-8-5-9(13)2-3-10(8)14/h2-5H,6H2,1H3,(H2,15,18) |
| InChIKey | PUOYFVHFKMIMOS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |