C10H6Br2F2N2 — CID 114692696
3,5-dibromo-1-[(2,5-difluorophenyl)methyl]pyrazole (PubChem CID 114692696) has the molecular formula C10H6Br2F2N2 and a molecular weight of 351.98 g/mol. Its IUPAC name is 3,5-dibromo-1-[(2,5-difluorophenyl)methyl]pyrazole.
| Compound Name | 3,5-dibromo-1-[(2,5-difluorophenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 114692696 |
| Molecular Formula | C10H6Br2F2N2 |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | 3,5-dibromo-1-[(2,5-difluorophenyl)methyl]pyrazole |
| SMILES | Fc1ccc(F)c(Cn2nc(Br)cc2Br)c1 |
| InChI | InChI=1S/C10H6Br2F2N2/c11-9-4-10(12)16(15-9)5-6-3-7(13)1-2-8(6)14/h1-4H,5H2 |
| InChIKey | ASMXTELMCRAOPH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |