C15H12BrF2N — CID 171369204
5-bromo-2-[(2,5-difluorophenyl)methyl]-1,3-dihydroisoindole (PubChem CID 171369204) has the molecular formula C15H12BrF2N and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-bromo-2-[(2,5-difluorophenyl)methyl]-1,3-dihydroisoindole.
| Compound Name | 5-bromo-2-[(2,5-difluorophenyl)methyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 171369204 |
| Molecular Formula | C15H12BrF2N |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 5-bromo-2-[(2,5-difluorophenyl)methyl]-1,3-dihydroisoindole |
| SMILES | Fc1ccc(F)c(CN2Cc3ccc(Br)cc3C2)c1 |
| InChI | InChI=1S/C15H12BrF2N/c16-13-2-1-10-7-19(8-11(10)5-13)9-12-6-14(17)3-4-15(12)18/h1-6H,7-9H2 |
| InChIKey | PUGGWBYQKFNHFT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |