C15H15ClFN — CID 162343848
2-benzyl-5-fluoro-1,3-dihydroisoindole;hydrochloride (PubChem CID 162343848) has the molecular formula C15H15ClFN and a molecular weight of 263.74 g/mol. Its IUPAC name is 2-benzyl-5-fluoro-1,3-dihydroisoindole;hydrochloride.
| Compound Name | 2-benzyl-5-fluoro-1,3-dihydroisoindole;hydrochloride |
|---|---|
| PubChem CID | 162343848 |
| Molecular Formula | C15H15ClFN |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-benzyl-5-fluoro-1,3-dihydroisoindole;hydrochloride |
| SMILES | Cl.Fc1ccc2c(c1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H14FN.ClH/c16-15-7-6-13-10-17(11-14(13)8-15)9-12-4-2-1-3-5-12;/h1-8H,9-11H2;1H |
| InChIKey | YBVPFNSDTKTIJM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |