C14H13ClN2 — CID 154963782
2-benzyl-6-chloro-1,3-dihydropyrrolo[3,4-c]pyridine (PubChem CID 154963782) has the molecular formula C14H13ClN2 and a molecular weight of 244.73 g/mol. Its IUPAC name is 2-benzyl-6-chloro-1,3-dihydropyrrolo[3,4-c]pyridine.
| Compound Name | 2-benzyl-6-chloro-1,3-dihydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 154963782 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-benzyl-6-chloro-1,3-dihydropyrrolo[3,4-c]pyridine |
| SMILES | Clc1cc2c(cn1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H13ClN2/c15-14-6-12-9-17(10-13(12)7-16-14)8-11-4-2-1-3-5-11/h1-7H,8-10H2 |
| InChIKey | KIPOXGQQTPOBBG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|