C16H15ClN2 — CID 59538692
6-benzyl-2-chloro-8-methylidene-5,7-dihydro-1,6-naphthyridine (PubChem CID 59538692) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 6-benzyl-2-chloro-8-methylidene-5,7-dihydro-1,6-naphthyridine.
| Compound Name | 6-benzyl-2-chloro-8-methylidene-5,7-dihydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 59538692 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-benzyl-2-chloro-8-methylidene-5,7-dihydro-1,6-naphthyridine |
| SMILES | C=C1CN(Cc2ccccc2)Cc2ccc(Cl)nc21 |
| InChI | InChI=1S/C16H15ClN2/c1-12-9-19(10-13-5-3-2-4-6-13)11-14-7-8-15(17)18-16(12)14/h2-8H,1,9-11H2 |
| InChIKey | LKXGWBHJKHPRLR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|