C17H16N2 — CID 130972580
6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-f]indole (PubChem CID 130972580) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-f]indole.
| Compound Name | 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-f]indole |
|---|---|
| PubChem CID | 130972580 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-f]indole |
| SMILES | c1ccc(CN2Cc3cc4cc[nH]c4cc3C2)cc1 |
| InChI | InChI=1S/C17H16N2/c1-2-4-13(5-3-1)10-19-11-15-8-14-6-7-18-17(14)9-16(15)12-19/h1-9,18H,10-12H2 |
| InChIKey | JAZHPBHWNBCUIO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |