C27H33Cl2CuN3 — CID 11307142
dichlorocopper;1,4,7-tribenzyl-1,4,7-triazonane (PubChem CID 11307142) has the molecular formula C27H33Cl2CuN3 and a molecular weight of 534.03 g/mol. Its IUPAC name is dichlorocopper;1,4,7-tribenzyl-1,4,7-triazonane.
| Compound Name | dichlorocopper;1,4,7-tribenzyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 11307142 |
| Molecular Formula | C27H33Cl2CuN3 |
| Molecular Weight | 534.03 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | dichlorocopper;1,4,7-tribenzyl-1,4,7-triazonane |
| SMILES | Cl[Cu]Cl.c1ccc(CN2CCN(Cc3ccccc3)CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H33N3.2ClH.Cu/c1-4-10-25(11-5-1)22-28-16-18-29(23-26-12-6-2-7-13-26)20-21-30(19-17-28)24-27-14-8-3-9-15-27;;;/h1-15H,16-24H2;2*1H;/q;;;+2/p-2 |
| InChIKey | LRVNDELQVOVHCM-UHFFFAOYSA-L |
| XLogP | 5.88 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |