About 1-benzylpyrrolidine;propane
1-benzylpyrrolidine;propane (PubChem CID 143692089) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-benzylpyrrolidine;propane.
Molecular Properties
| Compound Name | 1-benzylpyrrolidine;propane |
| PubChem CID | 143692089 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-benzylpyrrolidine;propane |
| SMILES | CCC.c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C3H8/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3-2/h1-3,6-7H,4-5,8-10H2;3H2,1-2H3 |
| InChIKey | OCJBRAYVVBAYSF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzylpyrrolidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrolidine;propane?
The IUPAC name of 1-benzylpyrrolidine;propane (CID 143692089) is 1-benzylpyrrolidine;propane.
What is the SMILES notation for 1-benzylpyrrolidine;propane?
The canonical SMILES for 1-benzylpyrrolidine;propane is CCC.c1ccc(CN2CCCC2)cc1.
What is the InChIKey of 1-benzylpyrrolidine;propane?
The InChIKey is OCJBRAYVVBAYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C3H8/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3-2/h1-3,6-7H,4-5,8-10H2;3H2,1-2H3.
What are the key properties of 1-benzylpyrrolidine;propane?
1-benzylpyrrolidine;propane has a molecular weight of 205.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrolidine;propane is sourced from PubChem (CID 143692089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).