About 1-benzylpiperidin-4-one;butane
1-benzylpiperidin-4-one;butane (PubChem CID 70571840) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-benzylpiperidin-4-one;butane.
Molecular Properties
| Compound Name | 1-benzylpiperidin-4-one;butane |
| PubChem CID | 70571840 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-benzylpiperidin-4-one;butane |
| SMILES | CCCC.O=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C12H15NO.C4H10/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;1-3-4-2/h1-5H,6-10H2;3-4H2,1-2H3 |
| InChIKey | YWCOKACMNQHJRO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpiperidin-4-one;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidin-4-one;butane?
The IUPAC name of 1-benzylpiperidin-4-one;butane (CID 70571840) is 1-benzylpiperidin-4-one;butane.
What is the SMILES notation for 1-benzylpiperidin-4-one;butane?
The canonical SMILES for 1-benzylpiperidin-4-one;butane is CCCC.O=C1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzylpiperidin-4-one;butane?
The InChIKey is YWCOKACMNQHJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C4H10/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;1-3-4-2/h1-5H,6-10H2;3-4H2,1-2H3.
What are the key properties of 1-benzylpiperidin-4-one;butane?
1-benzylpiperidin-4-one;butane has a molecular weight of 247.38 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidin-4-one;butane is sourced from PubChem (CID 70571840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).