About benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane
benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane (PubChem CID 90736428) has the molecular formula C22H28ClNO3
and a molecular weight of 389.92 g/mol. Its IUPAC name is benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane.
Molecular Properties
| Compound Name | benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane |
| PubChem CID | 90736428 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane |
| SMILES | CC.O=C(Cl)OCc1ccccc1.O=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C12H15NO.C8H7ClO2.C2H6/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;9-8(10)11-6-7-4-2-1-3-5-7;1-2/h1-5H,6-10H2;1-5H,6H2;1-2H3 |
| InChIKey | RILZVDPNIMOVCT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane?
The IUPAC name of benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane (CID 90736428) is benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane.
What is the SMILES notation for benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane?
The canonical SMILES for benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane is CC.O=C(Cl)OCc1ccccc1.O=C1CCN(Cc2ccccc2)CC1.
What is the InChIKey of benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane?
The InChIKey is RILZVDPNIMOVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C8H7ClO2.C2H6/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;9-8(10)11-6-7-4-2-1-3-5-7;1-2/h1-5H,6-10H2;1-5H,6H2;1-2H3.
What are the key properties of benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane?
benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane has a molecular weight of 389.92 g/mol, XLogP of 5.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbonochloridate;1-benzylpiperidin-4-one;ethane is sourced from PubChem (CID 90736428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).