About ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate
ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate (PubChem CID 142959894) has the molecular formula C18H29NO3
and a molecular weight of 307.43 g/mol. Its IUPAC name is ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate |
| PubChem CID | 142959894 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate |
| SMILES | CC.CC.COC(=O)C1CN(Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C14H17NO3.2C2H6/c1-18-14(17)12-10-15(8-7-13(12)16)9-11-5-3-2-4-6-11;2*1-2/h2-6,12H,7-10H2,1H3;2*1-2H3 |
| InChIKey | RDRFCMHCMSKXLS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate?
The IUPAC name of ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate (CID 142959894) is ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate.
What is the SMILES notation for ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate?
The canonical SMILES for ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate is CC.CC.COC(=O)C1CN(Cc2ccccc2)CCC1=O.
What is the InChIKey of ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate?
The InChIKey is RDRFCMHCMSKXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3.2C2H6/c1-18-14(17)12-10-15(8-7-13(12)16)9-11-5-3-2-4-6-11;2*1-2/h2-6,12H,7-10H2,1H3;2*1-2H3.
What are the key properties of ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate?
ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate has a molecular weight of 307.43 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1-benzyl-4-oxopiperidine-3-carboxylate is sourced from PubChem (CID 142959894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).