About methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate
methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate (PubChem CID 56771997) has the molecular formula C18H25NO5
and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate |
| PubChem CID | 56771997 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate |
| SMILES | CCOc1ccc(CN2CCC(=O)C(C(=O)OC)C2)cc1OCC |
| InChI | InChI=1S/C18H25NO5/c1-4-23-16-7-6-13(10-17(16)24-5-2)11-19-9-8-15(20)14(12-19)18(21)22-3/h6-7,10,14H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | OFJXRKUJSNSVIG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate?
The IUPAC name of methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate (CID 56771997) is methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate.
What is the SMILES notation for methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate?
The canonical SMILES for methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate is CCOc1ccc(CN2CCC(=O)C(C(=O)OC)C2)cc1OCC.
What is the InChIKey of methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate?
The InChIKey is OFJXRKUJSNSVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO5/c1-4-23-16-7-6-13(10-17(16)24-5-2)11-19-9-8-15(20)14(12-19)18(21)22-3/h6-7,10,14H,4-5,8-9,11-12H2,1-3H3.
What are the key properties of methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate?
methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate has a molecular weight of 335.40 g/mol, XLogP of 2.05, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(3,4-diethoxyphenyl)methyl]-4-oxopiperidine-3-carboxylate is sourced from PubChem (CID 56771997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).