C26H34N2O2 — CID 159724836
1-benzyl-3,3-dimethylpiperidin-4-one;1-benzylpiperidin-4-one (PubChem CID 159724836) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-benzyl-3,3-dimethylpiperidin-4-one;1-benzylpiperidin-4-one.
| Compound Name | 1-benzyl-3,3-dimethylpiperidin-4-one;1-benzylpiperidin-4-one |
|---|---|
| PubChem CID | 159724836 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-benzyl-3,3-dimethylpiperidin-4-one;1-benzylpiperidin-4-one |
| SMILES | CC1(C)CN(Cc2ccccc2)CCC1=O.O=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19NO.C12H15NO/c1-14(2)11-15(9-8-13(14)16)10-12-6-4-3-5-7-12;14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h3-7H,8-11H2,1-2H3;1-5H,6-10H2 |
| InChIKey | NAMQTTJQPZIDME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |