C17H21NO — CID 23366884
2-benzyl-8a-methyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 23366884) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-benzyl-8a-methyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 2-benzyl-8a-methyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 23366884 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-benzyl-8a-methyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | CC12CCC(=O)C=C1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H21NO/c1-17-9-7-16(19)11-15(17)8-10-18(13-17)12-14-5-3-2-4-6-14/h2-6,11H,7-10,12-13H2,1H3 |
| InChIKey | LNBWHZNWSJJWFX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |