C12H15F2NO2 — CID 138393770
1-benzyl-3,3-difluoropiperidin-4-one;hydrate (PubChem CID 138393770) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 1-benzyl-3,3-difluoropiperidin-4-one;hydrate.
| Compound Name | 1-benzyl-3,3-difluoropiperidin-4-one;hydrate |
|---|---|
| PubChem CID | 138393770 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-benzyl-3,3-difluoropiperidin-4-one;hydrate |
| SMILES | O.O=C1CCN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C12H13F2NO.H2O/c13-12(14)9-15(7-6-11(12)16)8-10-4-2-1-3-5-10;/h1-5H,6-9H2;1H2 |
| InChIKey | KDBQJZLMKOQERI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |