C16H19F2NO2 — CID 131847408
ethyl 2-(1-benzyl-3,3-difluoropiperidin-4-ylidene)acetate (PubChem CID 131847408) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-3,3-difluoropiperidin-4-ylidene)acetate.
| Compound Name | ethyl 2-(1-benzyl-3,3-difluoropiperidin-4-ylidene)acetate |
|---|---|
| PubChem CID | 131847408 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 2-(1-benzyl-3,3-difluoropiperidin-4-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CCN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C16H19F2NO2/c1-2-21-15(20)10-14-8-9-19(12-16(14,17)18)11-13-6-4-3-5-7-13/h3-7,10H,2,8-9,11-12H2,1H3 |
| InChIKey | SFJGQMQDSLOSHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|