ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate

C15H19NO2 — CID 787906

IUPACethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate
SMILESCCOC(=O)C1=CCN(Cc2ccccc2)CC1
InChIInChI=1S/C15H19NO2/c1-2-18-15(17)14-8-10-16(11-9-14)12-13-6-4-3-5-7-13/h3-8H,2,9-12H2,1H3
InChIKeyHPBHOJNKSYJCRT-UHFFFAOYSA-N
MW245.32 g/mol
LogP2.38
Rot. Bonds4

About ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate

ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate (PubChem CID 787906) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate.

Molecular Properties

Compound Nameethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate
PubChem CID787906
Molecular FormulaC15H19NO2
Molecular Weight245.32 g/mol
Exact Mass245.14
IUPAC Nameethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate
SMILESCCOC(=O)C1=CCN(Cc2ccccc2)CC1
InChIInChI=1S/C15H19NO2/c1-2-18-15(17)14-8-10-16(11-9-14)12-13-6-4-3-5-7-13/h3-8H,2,9-12H2,1H3
InChIKeyHPBHOJNKSYJCRT-UHFFFAOYSA-N
XLogP2.38
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate?
The IUPAC name of ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate (CID 787906) is ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate?
The canonical SMILES for ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate is CCOC(=O)C1=CCN(Cc2ccccc2)CC1.
What is the InChIKey of ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate?
The InChIKey is HPBHOJNKSYJCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-2-18-15(17)14-8-10-16(11-9-14)12-13-6-4-3-5-7-13/h3-8H,2,9-12H2,1H3.
What are the key properties of ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate?
ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate has a molecular weight of 245.32 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-3,6-dihydro-2H-pyridine-4-carboxylate is sourced from PubChem (CID 787906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).