C23H24N2O2 — CID 66863463
ethyl 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-6-carboxylate (PubChem CID 66863463) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 66863463 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 3-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(C3=CCN(Cc4ccccc4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C23H24N2O2/c1-2-27-23(26)19-8-9-20-21(15-24-22(20)14-19)18-10-12-25(13-11-18)16-17-6-4-3-5-7-17/h3-10,14-15,24H,2,11-13,16H2,1H3 |
| InChIKey | KQXSIEOLHVEXRE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |