C14H17N3 — CID 116997248
[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanamine (PubChem CID 116997248) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanamine.
| Compound Name | [4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanamine |
|---|---|
| PubChem CID | 116997248 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | [4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanamine |
| SMILES | NCN1CC=C(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C14H17N3/c15-10-17-7-5-11(6-8-17)13-9-16-14-4-2-1-3-12(13)14/h1-5,9,16H,6-8,10,15H2 |
| InChIKey | CQNZRMQVJDXICF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |