C15H18N2S — CID 116997247
2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol (PubChem CID 116997247) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol.
| Compound Name | 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol |
|---|---|
| PubChem CID | 116997247 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanethiol |
| SMILES | SCCN1CC=C(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C15H18N2S/c18-10-9-17-7-5-12(6-8-17)14-11-16-15-4-2-1-3-13(14)15/h1-5,11,16,18H,6-10H2 |
| InChIKey | NNTGUKUCLYSWDR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|