C27H30N4O3 — CID 11305667
3-[4-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-6,7-dimethoxyquinazolin-4-one (PubChem CID 11305667) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[4-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-6,7-dimethoxyquinazolin-4-one.
| Compound Name | 3-[4-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-6,7-dimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 11305667 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-[4-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-6,7-dimethoxyquinazolin-4-one |
| SMILES | COc1cc2ncn(CCCCN3CC=C(c4c[nH]c5ccccc45)CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C27H30N4O3/c1-33-25-15-21-24(16-26(25)34-2)29-18-31(27(21)32)12-6-5-11-30-13-9-19(10-14-30)22-17-28-23-8-4-3-7-20(22)23/h3-4,7-9,15-18,28H,5-6,10-14H2,1-2H3 |
| InChIKey | LKRJKIMAUCILHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|