C28H35FN4O — CID 18323653
6-fluoro-3-[1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indole (PubChem CID 18323653) has the molecular formula C28H35FN4O and a molecular weight of 462.61 g/mol. Its IUPAC name is 6-fluoro-3-[1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indole.
| Compound Name | 6-fluoro-3-[1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 18323653 |
| Molecular Formula | C28H35FN4O |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 6-fluoro-3-[1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3,6-dihydro-2H-pyridin-4-yl]-1H-indole |
| SMILES | COc1ccccc1N1CCN(CCCCN2CC=C(c3c[nH]c4cc(F)ccc34)CC2)CC1 |
| InChI | InChI=1S/C28H35FN4O/c1-34-28-7-3-2-6-27(28)33-18-16-32(17-19-33)13-5-4-12-31-14-10-22(11-15-31)25-21-30-26-20-23(29)8-9-24(25)26/h2-3,6-10,20-21,30H,4-5,11-19H2,1H3 |
| InChIKey | XXNTUPBQFFCQRM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|