C30H41ClN4O — CID 18323647
6-chloro-3-[1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]piperidin-4-yl]-1H-indole (PubChem CID 18323647) has the molecular formula C30H41ClN4O and a molecular weight of 509.14 g/mol. Its IUPAC name is 6-chloro-3-[1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]piperidin-4-yl]-1H-indole.
| Compound Name | 6-chloro-3-[1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 18323647 |
| Molecular Formula | C30H41ClN4O |
| Molecular Weight | 509.14 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 6-chloro-3-[1-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]piperidin-4-yl]-1H-indole |
| SMILES | COc1ccccc1N1CCN(CCCCCCN2CCC(c3c[nH]c4cc(Cl)ccc34)CC2)CC1 |
| InChI | InChI=1S/C30H41ClN4O/c1-36-30-9-5-4-8-29(30)35-20-18-34(19-21-35)15-7-3-2-6-14-33-16-12-24(13-17-33)27-23-32-28-22-25(31)10-11-26(27)28/h4-5,8-11,22-24,32H,2-3,6-7,12-21H2,1H3 |
| InChIKey | BZLXCNKEDLXTPX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.14 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|