C23H28ClN3O2 — CID 10597866
5-chloro-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3H-indol-2-one (PubChem CID 10597866) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 5-chloro-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3H-indol-2-one.
| Compound Name | 5-chloro-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 10597866 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-chloro-1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3H-indol-2-one |
| SMILES | COc1ccccc1N1CCN(CCCCN2C(=O)Cc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-29-22-7-3-2-6-21(22)26-14-12-25(13-15-26)10-4-5-11-27-20-9-8-19(24)16-18(20)17-23(27)28/h2-3,6-9,16H,4-5,10-15,17H2,1H3 |
| InChIKey | GHKGSDHAJGCGDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|