C16H22N2O — CID 112548439
1-(2-methoxyphenyl)-4-pent-4-ynylpiperazine (PubChem CID 112548439) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-pent-4-ynylpiperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-pent-4-ynylpiperazine |
|---|---|
| PubChem CID | 112548439 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-pent-4-ynylpiperazine |
| SMILES | C#CCCCN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C16H22N2O/c1-3-4-7-10-17-11-13-18(14-12-17)15-8-5-6-9-16(15)19-2/h1,5-6,8-9H,4,7,10-14H2,2H3 |
| InChIKey | PCXRJKYDOAQMRX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|