C22H29N3O3 — CID 91348674
1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-prop-2-ynylpyrrole-2,5-diol (PubChem CID 91348674) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-prop-2-ynylpyrrole-2,5-diol.
| Compound Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-prop-2-ynylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91348674 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-prop-2-ynylpyrrole-2,5-diol |
| SMILES | C#CCc1c(C)c(O)n(CCCN2CCN(c3ccccc3OC)CC2)c1O |
| InChI | InChI=1S/C22H29N3O3/c1-4-8-18-17(2)21(26)25(22(18)27)12-7-11-23-13-15-24(16-14-23)19-9-5-6-10-20(19)28-3/h1,5-6,9-10,26-27H,7-8,11-16H2,2-3H3 |
| InChIKey | FQCXBJKQWOOOIT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|