C21H28ClN3O3S — CID 42388721
5-chloro-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-methylbenzenesulfonamide (PubChem CID 42388721) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is 5-chloro-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42388721 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-chloro-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccccc1N1CCN(CCCNS(=O)(=O)c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C21H28ClN3O3S/c1-17-8-9-18(22)16-21(17)29(26,27)23-10-5-11-24-12-14-25(15-13-24)19-6-3-4-7-20(19)28-2/h3-4,6-9,16,23H,5,10-15H2,1-2H3 |
| InChIKey | XTGSVCKNIMZKFS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|