C19H24N4O5S — CID 42267812
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 42267812) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42267812 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1N1CCN(CCNS(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H24N4O5S/c1-28-18-8-4-2-6-16(18)22-14-12-21(13-15-22)11-10-20-29(26,27)19-9-5-3-7-17(19)23(24)25/h2-9,20H,10-15H2,1H3 |
| InChIKey | DKBCYKMZMGZRCZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|