C21H29N3O3S — CID 29344573
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-1-(3-methylphenyl)methanesulfonamide (PubChem CID 29344573) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 29344573 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-1-(3-methylphenyl)methanesulfonamide |
| SMILES | COc1ccccc1N1CCN(CCNS(=O)(=O)Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C21H29N3O3S/c1-18-6-5-7-19(16-18)17-28(25,26)22-10-11-23-12-14-24(15-13-23)20-8-3-4-9-21(20)27-2/h3-9,16,22H,10-15,17H2,1-2H3 |
| InChIKey | NDPQNVJLCFDGNU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |