C21H29N3O4S — CID 42267853
4-methoxy-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methylbenzenesulfonamide (PubChem CID 42267853) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-methoxy-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42267853 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-methoxy-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCN2CCN(c3ccccc3OC)CC2)cc1C |
| InChI | InChI=1S/C21H29N3O4S/c1-17-16-18(8-9-20(17)27-2)29(25,26)22-10-11-23-12-14-24(15-13-23)19-6-4-5-7-21(19)28-3/h4-9,16,22H,10-15H2,1-3H3 |
| InChIKey | ZRKOTMWZOSFTDH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |