C20H27N5O4 — CID 110184363
6-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-nitropyridin-2-amine (PubChem CID 110184363) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 6-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-nitropyridin-2-amine.
| Compound Name | 6-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110184363 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 6-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-nitropyridin-2-amine |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCCN2CCN(c3ccccc3OC)CC2)n1 |
| InChI | InChI=1S/C20H27N5O4/c1-28-18-7-4-3-6-16(18)24-14-12-23(13-15-24)11-5-10-21-20-17(25(26)27)8-9-19(22-20)29-2/h3-4,6-9H,5,10-15H2,1-2H3,(H,21,22) |
| InChIKey | FRYSFWSSYDHYSK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|