C11H19ClN4O3 — CID 70453186
N-(6-methoxy-3-nitro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride (PubChem CID 70453186) has the molecular formula C11H19ClN4O3 and a molecular weight of 290.75 g/mol. Its IUPAC name is N-(6-methoxy-3-nitro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-(6-methoxy-3-nitro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 70453186 |
| Molecular Formula | C11H19ClN4O3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(6-methoxy-3-nitro-2-pyridinyl)-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCCN(C)C)n1.Cl |
| InChI | InChI=1S/C11H18N4O3.ClH/c1-14(2)8-4-7-12-11-9(15(16)17)5-6-10(13-11)18-3;/h5-6H,4,7-8H2,1-3H3,(H,12,13);1H |
| InChIKey | OZJRDMNQLIQNNG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|