C19H26N6O6 — CID 110172492
N,N'-bis(6-methoxy-3-nitro-2-pyridinyl)heptane-1,7-diamine (PubChem CID 110172492) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is N,N'-bis(6-methoxy-3-nitro-2-pyridinyl)heptane-1,7-diamine.
| Compound Name | N,N'-bis(6-methoxy-3-nitro-2-pyridinyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 110172492 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N,N'-bis(6-methoxy-3-nitro-2-pyridinyl)heptane-1,7-diamine |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCCCCCCNc2nc(OC)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H26N6O6/c1-30-16-10-8-14(24(26)27)18(22-16)20-12-6-4-3-5-7-13-21-19-15(25(28)29)9-11-17(23-19)31-2/h8-11H,3-7,12-13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZJTYNOZYZMFWPE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|