C10H13N3O6 — CID 115321260
2-[2-[(6-methoxy-3-nitro-2-pyridinyl)amino]ethoxy]acetic acid (PubChem CID 115321260) has the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-[2-[(6-methoxy-3-nitro-2-pyridinyl)amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(6-methoxy-3-nitro-2-pyridinyl)amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 115321260 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[2-[(6-methoxy-3-nitro-2-pyridinyl)amino]ethoxy]acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(NCCOCC(=O)O)n1 |
| InChI | InChI=1S/C10H13N3O6/c1-18-8-3-2-7(13(16)17)10(12-8)11-4-5-19-6-9(14)15/h2-3H,4-6H2,1H3,(H,11,12)(H,14,15) |
| InChIKey | DAMQLZXTIIYVPQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|