C10H14N4O4 — CID 113286774
3-[(6-methoxy-3-nitro-2-pyridinyl)amino]-N-methylpropanamide (PubChem CID 113286774) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-[(6-methoxy-3-nitro-2-pyridinyl)amino]-N-methylpropanamide.
| Compound Name | 3-[(6-methoxy-3-nitro-2-pyridinyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 113286774 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-[(6-methoxy-3-nitro-2-pyridinyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1nc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O4/c1-11-8(15)5-6-12-10-7(14(16)17)3-4-9(13-10)18-2/h3-4H,5-6H2,1-2H3,(H,11,15)(H,12,13) |
| InChIKey | ZETLWNQFUVMOPP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|