C17H24N4OS — CID 89427881
N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1,3-thiazol-2-amine (PubChem CID 89427881) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1,3-thiazol-2-amine.
| Compound Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89427881 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1N1CCN(CCCNc2nccs2)CC1 |
| InChI | InChI=1S/C17H24N4OS/c1-22-16-6-3-2-5-15(16)21-12-10-20(11-13-21)9-4-7-18-17-19-8-14-23-17/h2-3,5-6,8,14H,4,7,9-13H2,1H3,(H,18,19) |
| InChIKey | HMFGABJELKKEPO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|