C24H29N4O4+ — CID 143764643
hydroxy-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,4-dioxonaphthalen-2-yl]azanium (PubChem CID 143764643) has the molecular formula C24H29N4O4+ and a molecular weight of 437.52 g/mol. Its IUPAC name is hydroxy-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,4-dioxonaphthalen-2-yl]azanium.
| Compound Name | hydroxy-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,4-dioxonaphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 143764643 |
| Molecular Formula | C24H29N4O4+ |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | hydroxy-[3-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,4-dioxonaphthalen-2-yl]azanium |
| SMILES | COc1ccccc1N1CCN(CCCNC2=C([NH2+]O)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H28N4O4/c1-32-20-10-5-4-9-19(20)28-15-13-27(14-16-28)12-6-11-25-21-22(26-31)24(30)18-8-3-2-7-17(18)23(21)29/h2-5,7-10,25-26,31H,6,11-16H2,1H3/p+1 |
| InChIKey | GDKHMOVHSHOZDN-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|