C28H29N3O2 — CID 130182218
2-methyl-3-[3-(4-naphthalen-1-ylpiperazin-1-yl)propylamino]naphthalene-1,4-dione (PubChem CID 130182218) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-methyl-3-[3-(4-naphthalen-1-ylpiperazin-1-yl)propylamino]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[3-(4-naphthalen-1-ylpiperazin-1-yl)propylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 130182218 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-methyl-3-[3-(4-naphthalen-1-ylpiperazin-1-yl)propylamino]naphthalene-1,4-dione |
| SMILES | CC1=C(NCCCN2CCN(c3cccc4ccccc34)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H29N3O2/c1-20-26(28(33)24-12-5-4-11-23(24)27(20)32)29-14-7-15-30-16-18-31(19-17-30)25-13-6-9-21-8-2-3-10-22(21)25/h2-6,8-13,29H,7,14-19H2,1H3 |
| InChIKey | WAEYLLFGOACDNA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|