C24H28N4O2 — CID 143764711
2-amino-3-[3-[4-(4-methylphenyl)piperazin-1-yl]propylamino]naphthalene-1,4-dione (PubChem CID 143764711) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-amino-3-[3-[4-(4-methylphenyl)piperazin-1-yl]propylamino]naphthalene-1,4-dione.
| Compound Name | 2-amino-3-[3-[4-(4-methylphenyl)piperazin-1-yl]propylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 143764711 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-amino-3-[3-[4-(4-methylphenyl)piperazin-1-yl]propylamino]naphthalene-1,4-dione |
| SMILES | Cc1ccc(N2CCN(CCCNC3=C(N)C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-7-9-18(10-8-17)28-15-13-27(14-16-28)12-4-11-26-22-21(25)23(29)19-5-2-3-6-20(19)24(22)30/h2-3,5-10,26H,4,11-16,25H2,1H3 |
| InChIKey | ISTCRDDHIXHLBO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|