C22H29N6O3+ — CID 143764820
2-amino-3-[2-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;hydroxyazanium (PubChem CID 143764820) has the molecular formula C22H29N6O3+ and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-amino-3-[2-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;hydroxyazanium.
| Compound Name | 2-amino-3-[2-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;hydroxyazanium |
|---|---|
| PubChem CID | 143764820 |
| Molecular Formula | C22H29N6O3+ |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-amino-3-[2-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]ethylamino]naphthalene-1,4-dione;hydroxyazanium |
| SMILES | Cc1cc(N2CCN(CCNC3=C(N)C(=O)c4ccccc4C3=O)CC2)ccn1.[NH3+]O |
| InChI | InChI=1S/C22H25N5O2.H4NO/c1-15-14-16(6-7-24-15)27-12-10-26(11-13-27)9-8-25-20-19(23)21(28)17-4-2-3-5-18(17)22(20)29;1-2/h2-7,14,25H,8-13,23H2,1H3;2H,1H3/q;+1 |
| InChIKey | FPMGACHZAAWOQN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|