C27H39N4O3+ — CID 143764701
2-amino-3-[3-(4-benzylpiperidin-1-yl)propylamino]naphthalene-1,4-dione;ethane;hydroxyazanium (PubChem CID 143764701) has the molecular formula C27H39N4O3+ and a molecular weight of 467.63 g/mol. Its IUPAC name is 2-amino-3-[3-(4-benzylpiperidin-1-yl)propylamino]naphthalene-1,4-dione;ethane;hydroxyazanium.
| Compound Name | 2-amino-3-[3-(4-benzylpiperidin-1-yl)propylamino]naphthalene-1,4-dione;ethane;hydroxyazanium |
|---|---|
| PubChem CID | 143764701 |
| Molecular Formula | C27H39N4O3+ |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 2-amino-3-[3-(4-benzylpiperidin-1-yl)propylamino]naphthalene-1,4-dione;ethane;hydroxyazanium |
| SMILES | CC.NC1=C(NCCCN2CCC(Cc3ccccc3)CC2)C(=O)c2ccccc2C1=O.[NH3+]O |
| InChI | InChI=1S/C25H29N3O2.C2H6.H4NO/c26-22-23(25(30)21-10-5-4-9-20(21)24(22)29)27-13-6-14-28-15-11-19(12-16-28)17-18-7-2-1-3-8-18;2*1-2/h1-5,7-10,19,27H,6,11-17,26H2;1-2H3;2H,1H3/q;;+1 |
| InChIKey | PZMGXTPKWURSOX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|