C29H32Cl2N2O — CID 122188500
N-[3-(4-benzylpiperidin-1-yl)propyl]-2,2-bis(4-chlorophenyl)acetamide (PubChem CID 122188500) has the molecular formula C29H32Cl2N2O and a molecular weight of 495.49 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-2,2-bis(4-chlorophenyl)acetamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2,2-bis(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 122188500 |
| Molecular Formula | C29H32Cl2N2O |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2,2-bis(4-chlorophenyl)acetamide |
| SMILES | O=C(NCCCN1CCC(Cc2ccccc2)CC1)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32Cl2N2O/c30-26-11-7-24(8-12-26)28(25-9-13-27(31)14-10-25)29(34)32-17-4-18-33-19-15-23(16-20-33)21-22-5-2-1-3-6-22/h1-3,5-14,23,28H,4,15-21H2,(H,32,34) |
| InChIKey | WMWWIRQFIVCLLM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|