C27H31ClN2O2S — CID 162364662
N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(4-chlorophenyl)benzenesulfonamide (PubChem CID 162364662) has the molecular formula C27H31ClN2O2S and a molecular weight of 483.08 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162364662 |
| Molecular Formula | C27H31ClN2O2S |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-4-(4-chlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCC(Cc2ccccc2)CC1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H31ClN2O2S/c28-26-11-7-24(8-12-26)25-9-13-27(14-10-25)33(31,32)29-17-4-18-30-19-15-23(16-20-30)21-22-5-2-1-3-6-22/h1-3,5-14,23,29H,4,15-21H2 |
| InChIKey | PLRQFQKAOBYRRD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|