C27H33ClN4O2 — CID 20968221
N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide (PubChem CID 20968221) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 20968221 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]acetamide |
| SMILES | O=C(CN1N=C(c2ccc(Cl)cc2)CCC1=O)NCCCN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H33ClN4O2/c28-24-9-7-23(8-10-24)25-11-12-27(34)32(30-25)20-26(33)29-15-4-16-31-17-13-22(14-18-31)19-21-5-2-1-3-6-21/h1-3,5-10,22H,4,11-20H2,(H,29,33) |
| InChIKey | QPTXVZJLELZXHH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|