C26H30ClN3O3 — CID 22431047
3-[2-[3-(4-benzylpiperidin-1-yl)propylamino]-2-oxoethyl]-5-chloro-1H-indole-2-carboxylic acid (PubChem CID 22431047) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 3-[2-[3-(4-benzylpiperidin-1-yl)propylamino]-2-oxoethyl]-5-chloro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-[3-(4-benzylpiperidin-1-yl)propylamino]-2-oxoethyl]-5-chloro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22431047 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 3-[2-[3-(4-benzylpiperidin-1-yl)propylamino]-2-oxoethyl]-5-chloro-1H-indole-2-carboxylic acid |
| SMILES | O=C(Cc1c(C(=O)O)[nH]c2ccc(Cl)cc12)NCCCN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30ClN3O3/c27-20-7-8-23-21(16-20)22(25(29-23)26(32)33)17-24(31)28-11-4-12-30-13-9-19(10-14-30)15-18-5-2-1-3-6-18/h1-3,5-8,16,19,29H,4,9-15,17H2,(H,28,31)(H,32,33) |
| InChIKey | ZGTMMUZMVIOKGK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|