C25H28ClN3O3 — CID 22431042
5-chloro-3-[2-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 22431042) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 5-chloro-3-[2-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22431042 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-chloro-3-[2-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1cccc(CN2CCC(CNC(=O)Cc3c(C(=O)O)[nH]c4ccc(Cl)cc34)CC2)c1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-16-3-2-4-18(11-16)15-29-9-7-17(8-10-29)14-27-23(30)13-21-20-12-19(26)5-6-22(20)28-24(21)25(31)32/h2-6,11-12,17,28H,7-10,13-15H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | KUNMMQUNRSVLGZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|