C26H28ClN3O5 — CID 167995934
N-(1-benzylpyrrolidin-3-yl)-5-chloro-3-ethyl-1H-indole-2-carboxamide;(E)-but-2-enedioic acid (PubChem CID 167995934) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-5-chloro-3-ethyl-1H-indole-2-carboxamide;(E)-but-2-enedioic acid.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-5-chloro-3-ethyl-1H-indole-2-carboxamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 167995934 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-5-chloro-3-ethyl-1H-indole-2-carboxamide;(E)-but-2-enedioic acid |
| SMILES | CCc1c(C(=O)NC2CCN(Cc3ccccc3)C2)[nH]c2ccc(Cl)cc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H24ClN3O.C4H4O4/c1-2-18-19-12-16(23)8-9-20(19)25-21(18)22(27)24-17-10-11-26(14-17)13-15-6-4-3-5-7-15;5-3(6)1-2-4(7)8/h3-9,12,17,25H,2,10-11,13-14H2,1H3,(H,24,27);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MFTGSIJIKLIQHV-WLHGVMLRSA-N |
| XLogP | 4.10 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|