C22H24FN3O — CID 46964182
N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-3-methyl-1H-indole-2-carboxamide (PubChem CID 46964182) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46964182 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCN(Cc3cccc(F)c3)CC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24FN3O/c1-15-19-7-2-3-8-20(19)25-21(15)22(27)24-18-9-11-26(12-10-18)14-16-5-4-6-17(23)13-16/h2-8,13,18,25H,9-12,14H2,1H3,(H,24,27) |
| InChIKey | ISCNSTLCZWUZIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|